Products 142266-35-1
CAS 142266-35-1 is the registry number for Methyl (2E)-3-(4-(methoxymethoxy)-3-nitrophenyl)prop-2-enoate. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
Methyl (E)-3-[4-(methoxymethoxy)-3-nitrophenyl]prop-2-enoate (CAS 142266-35-1) is a chemical compound with the molecular formula C12H13NO6 and a molecular weight of 267.23 g/mol. IUPAC name: methyl (E)-3-[4-(methoxymethoxy)-3-nitrophenyl]prop-2-enoate. InChIKey: WAMLPUXAXKAAKS-GQCTYLIASA-N.
| Molecular formula | C12H13NO6 |
|---|---|
| Molecular weight | 267.23 g/mol |
| IUPAC name | methyl (E)-3-[4-(methoxymethoxy)-3-nitrophenyl]prop-2-enoate |
| InChIKey | WAMLPUXAXKAAKS-GQCTYLIASA-N |
| SMILES | COCOC1=C(C=C(C=C1)/C=C/C(=O)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)