CAS 1432681-01-0 appears in our catalog under these names: 3-Fluoro-3-(2-fluorophenyl)azetidine hydrochloride, 98%, 3-Fluoro-3-(2-fluorophenyl)azetidine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-fluoro-3-(2-fluorophenyl)azetidine;hydrochloride (CAS 1432681-01-0) is a chemical compound with the molecular formula C9H10ClF2N and a molecular weight of 205.63 g/mol. IUPAC name: 3-fluoro-3-(2-fluorophenyl)azetidine;hydrochloride. InChIKey: YZOZNARZOKRFPJ-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF2N |
|---|---|
| Molecular weight | 205.63 g/mol |
| IUPAC name | 3-fluoro-3-(2-fluorophenyl)azetidine;hydrochloride |
| InChIKey | YZOZNARZOKRFPJ-UHFFFAOYSA-N |
| SMILES | C1C(CN1)(C2=CC=CC=C2F)F.Cl |
Computed by PubChem (NCBI)