Products 143814-63-5
CAS 143814-63-5 is the registry number for 1,4-dimethoxy-2-nitro-3-[(E)-2-nitroethenyl]benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
1,4-dimethoxy-2-nitro-3-[(E)-2-nitroethenyl]benzene (CAS 143814-63-5) is a chemical compound with the molecular formula C10H10N2O6 and a molecular weight of 254.20 g/mol. IUPAC name: 1,4-dimethoxy-2-nitro-3-[(E)-2-nitroethenyl]benzene. InChIKey: PSBWJWZJTFUALX-AATRIKPKSA-N.
| Molecular formula | C10H10N2O6 |
|---|---|
| Molecular weight | 254.20 g/mol |
| IUPAC name | 1,4-dimethoxy-2-nitro-3-[(E)-2-nitroethenyl]benzene |
| InChIKey | PSBWJWZJTFUALX-AATRIKPKSA-N |
| SMILES | COC1=C(C(=C(C=C1)OC)[N+](=O)[O-])/C=C/[N+](=O)[O-] |
Computed by PubChem (NCBI)