CAS 14389-06-1 appears in our catalog under these names: 5–Chloro–7–methylindoline–2,3–dione, 5-Chloro-7-methylisatin, 97% , 5-Chloro-7-methylindoline-2,3-dione 97%, 5-Chloro-7-methylisatin, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100g, 10g, 25g.
5-chloro-7-methyl-1H-indole-2,3-dione (CAS 14389-06-1) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: 5-chloro-7-methyl-1H-indole-2,3-dione. InChIKey: LDFQLYHDZZPAGN-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 5-chloro-7-methyl-1H-indole-2,3-dione |
| InChIKey | LDFQLYHDZZPAGN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1NC(=O)C2=O)Cl |
Computed by PubChem (NCBI)