CAS 146463-74-3 appears in our catalog under these names: 4-(Chloromethyl)-6,7-dimethyl-2h-chromen-2-one, 95%, 4-(chloromethyl)-6,7-dimethyl-2H-chromen-2-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 2,5g.
4-(chloromethyl)-6,7-dimethylchromen-2-one (CAS 146463-74-3) is a chemical compound with the molecular formula C12H11ClO2 and a molecular weight of 222.67 g/mol. IUPAC name: 4-(chloromethyl)-6,7-dimethylchromen-2-one. InChIKey: CLYXXOOLIRDIPC-UHFFFAOYSA-N.
| Molecular formula | C12H11ClO2 |
|---|---|
| Molecular weight | 222.67 g/mol |
| IUPAC name | 4-(chloromethyl)-6,7-dimethylchromen-2-one |
| InChIKey | CLYXXOOLIRDIPC-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C)OC(=O)C=C2CCl |
Computed by PubChem (NCBI)