CAS 72019-91-1 is the registry number for 1-Chloro-6-methoxy-3,4-dihydro-naphthalene-2-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
1-chloro-6-methoxy-3,4-dihydronaphthalene-2-carbaldehyde (CAS 72019-91-1) is a chemical compound with the molecular formula C12H11ClO2 and a molecular weight of 222.67 g/mol. IUPAC name: 1-chloro-6-methoxy-3,4-dihydronaphthalene-2-carbaldehyde. InChIKey: BDKNTMQPRHCITN-UHFFFAOYSA-N.
| Molecular formula | C12H11ClO2 |
|---|---|
| Molecular weight | 222.67 g/mol |
| IUPAC name | 1-chloro-6-methoxy-3,4-dihydronaphthalene-2-carbaldehyde |
| InChIKey | BDKNTMQPRHCITN-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=C(CC2)C=O)Cl |
Computed by PubChem (NCBI)