CAS 27463-38-3 is the registry number for 5-(4-Chlorophenyl)-3-hydroxycyclohex-2-en-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-(4-chlorophenyl)cyclohexane-1,3-dione (CAS 27463-38-3) is a chemical compound with the molecular formula C12H11ClO2 and a molecular weight of 222.67 g/mol. IUPAC name: 5-(4-chlorophenyl)cyclohexane-1,3-dione. InChIKey: MAFYKXZPGMHTIA-UHFFFAOYSA-N.
| Molecular formula | C12H11ClO2 |
|---|---|
| Molecular weight | 222.67 g/mol |
| IUPAC name | 5-(4-chlorophenyl)cyclohexane-1,3-dione |
| InChIKey | MAFYKXZPGMHTIA-UHFFFAOYSA-N |
| SMILES | C1C(CC(=O)CC1=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)