CAS 41295-58-3 is the registry number for 4-(Chloromethyl)-5,7-dimethyl-2h-chromen-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
4-(chloromethyl)-5,7-dimethylchromen-2-one (CAS 41295-58-3) is a chemical compound with the molecular formula C12H11ClO2 and a molecular weight of 222.67 g/mol. IUPAC name: 4-(chloromethyl)-5,7-dimethylchromen-2-one. InChIKey: UAHMLRJDORGFNT-UHFFFAOYSA-N.
| Molecular formula | C12H11ClO2 |
|---|---|
| Molecular weight | 222.67 g/mol |
| IUPAC name | 4-(chloromethyl)-5,7-dimethylchromen-2-one |
| InChIKey | UAHMLRJDORGFNT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=CC(=O)OC2=C1)CCl)C |
Computed by PubChem (NCBI)