CAS 55579-68-5 appears in our catalog under these names: 5–(2–Chlorophenyl)cyclohexane–1,3–dione, 5-(2-Chlorophenyl)cyclohexane-1,3-dione, 5-(2-Chlorophenyl)cyclohexane-1,3-dione, 95%, 5-(2-Chlorophenyl)cyclohexane-1,3-dione 97%, 5-(2-Chlorophenyl)cyclohexane-1,3-dione, 98%. Offered by: GLPBio, Biosynth, Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 500mg, 1000mg, 2000mg, 5000mg, 5g, 100mg.
5-(2-chlorophenyl)cyclohexane-1,3-dione (CAS 55579-68-5) is a chemical compound with the molecular formula C12H11ClO2 and a molecular weight of 222.67 g/mol. IUPAC name: 5-(2-chlorophenyl)cyclohexane-1,3-dione. InChIKey: BPFBAVBCEHCMFU-UHFFFAOYSA-N.
| Molecular formula | C12H11ClO2 |
|---|---|
| Molecular weight | 222.67 g/mol |
| IUPAC name | 5-(2-chlorophenyl)cyclohexane-1,3-dione |
| InChIKey | BPFBAVBCEHCMFU-UHFFFAOYSA-N |
| SMILES | C1C(CC(=O)CC1=O)C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)