Products 2033088-75-2

CAS 2033088-75-2 is the registry number for Ozagrel Impurity 16. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 3-[4-(chloromethyl)phenyl]prop-2-ynoate (CAS 2033088-75-2) is a chemical compound with the molecular formula C12H11ClO2 and a molecular weight of 222.67 g/mol. IUPAC name: ethyl 3-[4-(chloromethyl)phenyl]prop-2-ynoate. InChIKey: UHLUMANHYXDFIX-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11ClO2
Molecular weight222.67 g/mol
IUPAC nameethyl 3-[4-(chloromethyl)phenyl]prop-2-ynoate
InChIKeyUHLUMANHYXDFIX-UHFFFAOYSA-N
SMILESCCOC(=O)C#CC1=CC=C(C=C1)CCl

Computed by PubChem (NCBI)