Products 2252382-54-8
CAS 2252382-54-8 is the registry number for 3-(4-Chlorophenyl)bicyclo[1.1.1]pentane-1-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-chlorophenyl)bicyclo[1.1.1]pentane-1-carboxylic acid (CAS 2252382-54-8) is a chemical compound with the molecular formula C12H11ClO2 and a molecular weight of 222.67 g/mol. IUPAC name: 3-(4-chlorophenyl)bicyclo[1.1.1]pentane-1-carboxylic acid. InChIKey: DDORVEUZSDLWRI-UHFFFAOYSA-N.
| Molecular formula | C12H11ClO2 |
|---|---|
| Molecular weight | 222.67 g/mol |
| IUPAC name | 3-(4-chlorophenyl)bicyclo[1.1.1]pentane-1-carboxylic acid |
| InChIKey | DDORVEUZSDLWRI-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C2)C(=O)O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)