CAS 55579-71-0 appears in our catalog under these names: 5-(3-Chlorophenyl)cyclohexane-1,3-dione, 98%, 5-(3-Chlorophenyl)cyclohexane-1,3-dione, 5-(3-Chlorophenyl)Cyclohexane-1,3-Dione, 98%, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 10g, 1g, 500mg, 250mg, 1000mg, 2000mg.
5-(3-chlorophenyl)cyclohexane-1,3-dione (CAS 55579-71-0) is a chemical compound with the molecular formula C12H11ClO2 and a molecular weight of 222.67 g/mol. IUPAC name: 5-(3-chlorophenyl)cyclohexane-1,3-dione. InChIKey: YSNSALYPQQBIDC-UHFFFAOYSA-N.
| Molecular formula | C12H11ClO2 |
|---|---|
| Molecular weight | 222.67 g/mol |
| IUPAC name | 5-(3-chlorophenyl)cyclohexane-1,3-dione |
| InChIKey | YSNSALYPQQBIDC-UHFFFAOYSA-N |
| SMILES | C1C(CC(=O)CC1=O)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)