CAS 41295-57-2 appears in our catalog under these names: 4-Chloromethyl-7,8-dimethyl-chromen-2-one, 95%, 4-(Chloromethyl)-7,8-dimethyl-2H-chromen-2-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 1g, 250mg, 5g, 0,5g.
4-(chloromethyl)-7,8-dimethylchromen-2-one (CAS 41295-57-2) is a chemical compound with the molecular formula C12H11ClO2 and a molecular weight of 222.67 g/mol. IUPAC name: 4-(chloromethyl)-7,8-dimethylchromen-2-one. InChIKey: IVPYSAYHCFQONM-UHFFFAOYSA-N.
| Molecular formula | C12H11ClO2 |
|---|---|
| Molecular weight | 222.67 g/mol |
| IUPAC name | 4-(chloromethyl)-7,8-dimethylchromen-2-one |
| InChIKey | IVPYSAYHCFQONM-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C(=CC(=O)O2)CCl)C |
Computed by PubChem (NCBI)