CAS 14731-27-2 appears in our catalog under these names: 5-(Benzylamino)-1,3,4-thiadiazole-2-thiol, 5-(Benzylamino)-1,3,4-thiadiazole-2-thiol, 98%, 98%, 5-(benzylamino)-2,3-dihydro-1,3,4-thiadiazole-2-thione, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g.
5-(benzylamino)-3H-1,3,4-thiadiazole-2-thione (CAS 14731-27-2) is a chemical compound with the molecular formula C9H9N3S2 and a molecular weight of 223.3 g/mol. IUPAC name: 5-(benzylamino)-3H-1,3,4-thiadiazole-2-thione. InChIKey: QWHHWOMUBFYDRB-UHFFFAOYSA-N.
| Molecular formula | C9H9N3S2 |
|---|---|
| Molecular weight | 223.3 g/mol |
| IUPAC name | 5-(benzylamino)-3H-1,3,4-thiadiazole-2-thione |
| InChIKey | QWHHWOMUBFYDRB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=NNC(=S)S2 |
Computed by PubChem (NCBI)