CAS 889940-61-8 is the registry number for 3-(4-(Methylsulfanyl)phenyl)-2,5-dihydro-1,2,4-thiadiazol-5-imine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(4-methylsulfanylphenyl)-1,2,4-thiadiazol-5-amine (CAS 889940-61-8) is a chemical compound with the molecular formula C9H9N3S2 and a molecular weight of 223.3 g/mol. IUPAC name: 3-(4-methylsulfanylphenyl)-1,2,4-thiadiazol-5-amine. InChIKey: VGDLSMKOVNEJIA-UHFFFAOYSA-N.
| Molecular formula | C9H9N3S2 |
|---|---|
| Molecular weight | 223.3 g/mol |
| IUPAC name | 3-(4-methylsulfanylphenyl)-1,2,4-thiadiazol-5-amine |
| InChIKey | VGDLSMKOVNEJIA-UHFFFAOYSA-N |
| SMILES | CSC1=CC=C(C=C1)C2=NSC(=N2)N |
Computed by PubChem (NCBI)