CAS 148231-12-3 appears in our catalog under these names: 5,8–Dibromoquinoxaline, 5,8-Dibromoquinoxaline 98%, 5,8-DIBROMOQUINOXALINE, 97%, 5,8-Dibromoquinoxaline, 95%. Offered by: GLPBio, Ambeed, Sigma-Aldrich, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 25g, 10g.
5,8-dibromoquinoxaline (CAS 148231-12-3) is a chemical compound with the molecular formula C8H4Br2N2 and a molecular weight of 287.94 g/mol. IUPAC name: 5,8-dibromoquinoxaline. InChIKey: ZPZBXKVJNVNNET-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2N2 |
|---|---|
| Molecular weight | 287.94 g/mol |
| IUPAC name | 5,8-dibromoquinoxaline |
| InChIKey | ZPZBXKVJNVNNET-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1Br)N=CC=N2)Br |
Computed by PubChem (NCBI)