CAS 148248-25-3 is the registry number for (2R)-2-[[(2S)-2-aminopropanoyl]amino]propanoic acid,hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 250mg, 500mg, 1g.
(2R)-2-[[(2S)-2-aminopropanoyl]amino]propanoic acid;hydrochloride (CAS 148248-25-3) is a chemical compound with the molecular formula C6H13ClN2O3 and a molecular weight of 196.63 g/mol. IUPAC name: (2R)-2-[[(2S)-2-aminopropanoyl]amino]propanoic acid;hydrochloride. InChIKey: YKZTXOMGFUVZSN-RFKZQXLXSA-N.
| Molecular formula | C6H13ClN2O3 |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | (2R)-2-[[(2S)-2-aminopropanoyl]amino]propanoic acid;hydrochloride |
| InChIKey | YKZTXOMGFUVZSN-RFKZQXLXSA-N |
| SMILES | C[C@@H](C(=O)N[C@H](C)C(=O)O)N.Cl |
Computed by PubChem (NCBI)