Products 1487140-88-4
CAS 1487140-88-4 is the registry number for 4-(4-chlorophenyl)-1,2-oxazole-5-carboxylic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg.
4-(4-chlorophenyl)-1,2-oxazole-5-carboxylic acid (CAS 1487140-88-4) is a chemical compound with the molecular formula C10H6ClNO3 and a molecular weight of 223.61 g/mol. IUPAC name: 4-(4-chlorophenyl)-1,2-oxazole-5-carboxylic acid. InChIKey: KRIPMIFCHQEYRS-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO3 |
|---|---|
| Molecular weight | 223.61 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-1,2-oxazole-5-carboxylic acid |
| InChIKey | KRIPMIFCHQEYRS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(ON=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)