CAS 1487612-17-8 is the registry number for 1-(4,7-Dichloro-1H-indol-3-yl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4,7-dichloro-1H-indol-3-yl)ethanone (CAS 1487612-17-8) is a chemical compound with the molecular formula C10H7Cl2NO and a molecular weight of 228.07 g/mol. IUPAC name: 1-(4,7-dichloro-1H-indol-3-yl)ethanone. InChIKey: OEJLGYNOCHTUHU-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NO |
|---|---|
| Molecular weight | 228.07 g/mol |
| IUPAC name | 1-(4,7-dichloro-1H-indol-3-yl)ethanone |
| InChIKey | OEJLGYNOCHTUHU-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CNC2=C(C=CC(=C12)Cl)Cl |
Computed by PubChem (NCBI)