CAS 1493953-92-6 is the registry number for 5-(4-Chlorophenyl)-1H-1,2,3-triazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(4-chlorophenyl)-2H-triazole-4-carboxylic acid (CAS 1493953-92-6) is a chemical compound with the molecular formula C9H6ClN3O2 and a molecular weight of 223.61 g/mol. IUPAC name: 5-(4-chlorophenyl)-2H-triazole-4-carboxylic acid. InChIKey: HQESNQQQZZQUAK-UHFFFAOYSA-N.
| Molecular formula | C9H6ClN3O2 |
|---|---|
| Molecular weight | 223.61 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-2H-triazole-4-carboxylic acid |
| InChIKey | HQESNQQQZZQUAK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NNN=C2C(=O)O)Cl |
Computed by PubChem (NCBI)