Products 1505703-48-9
CAS 1505703-48-9 is the registry number for 4-Bromo-2-fluorophenyl chloroformate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(4-bromo-2-fluorophenyl) carbonochloridate (CAS 1505703-48-9) is a chemical compound with the molecular formula C7H3BrClFO2 and a molecular weight of 253.45 g/mol. IUPAC name: (4-bromo-2-fluorophenyl) carbonochloridate. InChIKey: AWBIFSSEGLZDRJ-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO2 |
|---|---|
| Molecular weight | 253.45 g/mol |
| IUPAC name | (4-bromo-2-fluorophenyl) carbonochloridate |
| InChIKey | AWBIFSSEGLZDRJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)F)OC(=O)Cl |
Computed by PubChem (NCBI)