CAS 1512254-69-1 is the registry number for 8-Methylimidazo[1,2-a]pyridine-2,3-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-methylimidazo[1,2-a]pyridine-2,3-dicarboxylic acid (CAS 1512254-69-1) is a chemical compound with the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. IUPAC name: 8-methylimidazo[1,2-a]pyridine-2,3-dicarboxylic acid. InChIKey: JXQSZVABDKYWDR-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O4 |
|---|---|
| Molecular weight | 220.18 g/mol |
| IUPAC name | 8-methylimidazo[1,2-a]pyridine-2,3-dicarboxylic acid |
| InChIKey | JXQSZVABDKYWDR-UHFFFAOYSA-N |
| SMILES | CC1=CC=CN2C1=NC(=C2C(=O)O)C(=O)O |
Computed by PubChem (NCBI)