CAS 152353-95-2 is the registry number for (1S,3S)-3-(4-(Trifluoromethyl)phenyl)cyclobutane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-[4-(trifluoromethyl)phenyl]cyclobutane-1-carboxylic acid (CAS 152353-95-2) is a chemical compound with the molecular formula C12H11F3O2 and a molecular weight of 244.21 g/mol. IUPAC name: 3-[4-(trifluoromethyl)phenyl]cyclobutane-1-carboxylic acid. InChIKey: FAIXZJSJPCRBSS-UHFFFAOYSA-N.
| Molecular formula | C12H11F3O2 |
|---|---|
| Molecular weight | 244.21 g/mol |
| IUPAC name | 3-[4-(trifluoromethyl)phenyl]cyclobutane-1-carboxylic acid |
| InChIKey | FAIXZJSJPCRBSS-UHFFFAOYSA-N |
| SMILES | C1C(CC1C(=O)O)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)