CAS 1523606-41-8 appears in our catalog under these names: 5-Azabicyclo(2.2.2)octan-2-one hemioxalate, 2-Oxa-5-azabicyclo[2.2.2]octane hemioxalate 95%, 2-Oxa-5-azabicyclo[2.2.2]octane oxalate(2:1), 95%, 95%, 2-Oxa-5-azabicyclo[2.2.2]octane hemioxalate, 9500%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 25mg, 100mg, 50mg, 250mg, 500mg, 1g, 5g, 10g.
Bis(2-oxa-5-azabicyclo[2.2.2]octane);oxalic acid (CAS 1523606-41-8) is a chemical compound with the molecular formula C14H24N2O6 and a molecular weight of 316.35 g/mol. IUPAC name: bis(2-oxa-5-azabicyclo[2.2.2]octane);oxalic acid. InChIKey: PWHSLHBTQUHNGP-UHFFFAOYSA-N.
| Molecular formula | C14H24N2O6 |
|---|---|
| Molecular weight | 316.35 g/mol |
| IUPAC name | bis(2-oxa-5-azabicyclo[2.2.2]octane);oxalic acid |
| InChIKey | PWHSLHBTQUHNGP-UHFFFAOYSA-N |
| SMILES | C1CC2COC1CN2.C1CC2COC1CN2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)