Products 2306255-62-7

CAS 2306255-62-7 is the registry number for (1R,4R)-2-Oxa-5-azabicyclo[2.2.2]octane,oxalic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Bis((1R,4R)-2-oxa-5-azabicyclo[2.2.2]octane);oxalic acid (CAS 2306255-62-7) is a chemical compound with the molecular formula C14H24N2O6 and a molecular weight of 316.35 g/mol. IUPAC name: bis((1R,4R)-2-oxa-5-azabicyclo[2.2.2]octane);oxalic acid. InChIKey: PWHSLHBTQUHNGP-LDCPCGJSSA-N.

Identity
Molecular formulaC14H24N2O6
Molecular weight316.35 g/mol
IUPAC namebis((1R,4R)-2-oxa-5-azabicyclo[2.2.2]octane);oxalic acid
InChIKeyPWHSLHBTQUHNGP-LDCPCGJSSA-N
SMILESC1C[C@@H]2CO[C@H]1CN2.C1C[C@@H]2CO[C@H]1CN2.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)