Products 1523618-05-4
CAS 1523618-05-4 is the registry number for 5-Azaspiro[3.4]octane Hemioxalate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Bis(5-azaspiro[3.4]octane);oxalic acid (CAS 1523618-05-4) is a chemical compound with the molecular formula C16H28N2O4 and a molecular weight of 312.40 g/mol. IUPAC name: bis(5-azaspiro[3.4]octane);oxalic acid. InChIKey: CSOGJCFXGYETQI-UHFFFAOYSA-N.
| Molecular formula | C16H28N2O4 |
|---|---|
| Molecular weight | 312.40 g/mol |
| IUPAC name | bis(5-azaspiro[3.4]octane);oxalic acid |
| InChIKey | CSOGJCFXGYETQI-UHFFFAOYSA-N |
| SMILES | C1CC2(C1)CCCN2.C1CC2(C1)CCCN2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)