CAS 1523618-29-2 appears in our catalog under these names: 5-Oxa-2-azaspiro[3.4]octane oxalate(2:1), 98%, 5-Oxa-2-azaspiro[3.4]octane oxalate(2:1), 98+%, 5-Oxa-2-azaspiro[3.4]octane oxalate(2:1), 98%, 98%, 5-Oxa-2-azaspiro(3.4)octane hemioxalate. Offered by: Fluorochem, Ambeed, Chemat, Biosynth. Available pack sizes: 100mg, 250mg, 1g, 50mg, 500mg.
Bis(5-oxa-2-azaspiro[3.4]octane);oxalic acid (CAS 1523618-29-2) is a chemical compound with the molecular formula C14H24N2O6 and a molecular weight of 316.35 g/mol. IUPAC name: bis(5-oxa-2-azaspiro[3.4]octane);oxalic acid. InChIKey: OZSFCICIMABNNL-UHFFFAOYSA-N.
| Molecular formula | C14H24N2O6 |
|---|---|
| Molecular weight | 316.35 g/mol |
| IUPAC name | bis(5-oxa-2-azaspiro[3.4]octane);oxalic acid |
| InChIKey | OZSFCICIMABNNL-UHFFFAOYSA-N |
| SMILES | C1CC2(CNC2)OC1.C1CC2(CNC2)OC1.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)