Products 1542264-41-4
CAS 1542264-41-4 appears in our catalog under these names: 1-isopropylsulfonylindole-3-carboxylic acid, 97%, 97%, 1-ISOPROPYLSULFONYLINDOLE-3-CARBOXYLIC ACID, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg.
1-propan-2-ylsulfonylindole-3-carboxylic acid (CAS 1542264-41-4) is a chemical compound with the molecular formula C12H13NO4S and a molecular weight of 267.30 g/mol. IUPAC name: 1-propan-2-ylsulfonylindole-3-carboxylic acid. InChIKey: VUECPTLASBKKSD-UHFFFAOYSA-N.
| Molecular formula | C12H13NO4S |
|---|---|
| Molecular weight | 267.30 g/mol |
| IUPAC name | 1-propan-2-ylsulfonylindole-3-carboxylic acid |
| InChIKey | VUECPTLASBKKSD-UHFFFAOYSA-N |
| SMILES | CC(C)S(=O)(=O)N1C=C(C2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)