Products 1556154-44-9

CAS 1556154-44-9 is the registry number for 3-Chloro-1H-indole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-chloro-1H-indole-4-carboxylic acid (CAS 1556154-44-9) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: 3-chloro-1H-indole-4-carboxylic acid. InChIKey: ZEQDVTCFHYZUKW-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6ClNO2
Molecular weight195.60 g/mol
IUPAC name3-chloro-1H-indole-4-carboxylic acid
InChIKeyZEQDVTCFHYZUKW-UHFFFAOYSA-N
SMILESC1=CC(=C2C(=C1)NC=C2Cl)C(=O)O

Computed by PubChem (NCBI)