Products 155861-51-1
CAS 155861-51-1 is the registry number for 9,10-Dimethoxycanthin-6-one. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, Get quote.
12,13-dimethoxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-2-one (CAS 155861-51-1) is a chemical compound with the molecular formula C16H12N2O3 and a molecular weight of 280.28 g/mol. IUPAC name: 12,13-dimethoxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-2-one. InChIKey: VKMIBFAQYHUWCU-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O3 |
|---|---|
| Molecular weight | 280.28 g/mol |
| IUPAC name | 12,13-dimethoxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-2-one |
| InChIKey | VKMIBFAQYHUWCU-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C3=C4N2C(=O)C=CC4=NC=C3)OC |
Computed by PubChem (NCBI)