CAS 156635-88-0 appears in our catalog under these names: 4-Benzyloxy-3,5-difluorophenylboronic acid, 97%, 4–Benzyloxy–3,5–Difluorophenylboronic Acid, (4-(Benzyloxy)-3,5-difluorophenyl)boronic acid 97%, (4-(Benzyloxy)-3,5-difluorophenyl)boronic acid, 97%, 97%, (4-(Benzyloxy)-3,5-difluorophenyl)boronic acid, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 10g, 100g, 5g, 250mg, 100mg.
(3,5-difluoro-4-phenylmethoxyphenyl)boronic acid (CAS 156635-88-0) is a chemical compound with the molecular formula C13H11BF2O3 and a molecular weight of 264.03 g/mol. IUPAC name: (3,5-difluoro-4-phenylmethoxyphenyl)boronic acid. InChIKey: YWUHRGQYLQMLHW-UHFFFAOYSA-N.
| Molecular formula | C13H11BF2O3 |
|---|---|
| Molecular weight | 264.03 g/mol |
| IUPAC name | (3,5-difluoro-4-phenylmethoxyphenyl)boronic acid |
| InChIKey | YWUHRGQYLQMLHW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)OCC2=CC=CC=C2)F)(O)O |
Computed by PubChem (NCBI)