CAS 160977-92-4 appears in our catalog under these names: N-Fmoc-4-(methylamino)benzoic Acid, 4-{((9H-fluoren-9-ylmethoxy)carbonyl)(methyl)amino}benzoic acid. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 2,5g, 250mg.
4-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]benzoic acid (CAS 160977-92-4) is a chemical compound with the molecular formula C23H19NO4 and a molecular weight of 373.4 g/mol. IUPAC name: 4-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]benzoic acid. InChIKey: HQOGMQFPENTFMI-UHFFFAOYSA-N.
| Molecular formula | C23H19NO4 |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | 4-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]benzoic acid |
| InChIKey | HQOGMQFPENTFMI-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=C(C=C1)C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)