Products 161291-72-1
CAS 161291-72-1 is the registry number for 4-(1,3-Dioxo-2,3-dihydro-1H-isoindol-2-yl)-2-methylbenzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(1,3-dioxoisoindol-2-yl)-2-methylbenzoic acid (CAS 161291-72-1) is a chemical compound with the molecular formula C16H11NO4 and a molecular weight of 281.26 g/mol. IUPAC name: 4-(1,3-dioxoisoindol-2-yl)-2-methylbenzoic acid. InChIKey: DMYCIRBSCFYQLA-UHFFFAOYSA-N.
| Molecular formula | C16H11NO4 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | 4-(1,3-dioxoisoindol-2-yl)-2-methylbenzoic acid |
| InChIKey | DMYCIRBSCFYQLA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N2C(=O)C3=CC=CC=C3C2=O)C(=O)O |
Computed by PubChem (NCBI)