CAS 1613150-00-7 is the registry number for 7-(Trifluoromethyl)-(1,2,4)triazolo(4,3-a)pyridin-3-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7-(trifluoromethyl)-2H-[1,2,4]triazolo[4,3-a]pyridin-3-one (CAS 1613150-00-7) is a chemical compound with the molecular formula C7H4F3N3O and a molecular weight of 203.12 g/mol. IUPAC name: 7-(trifluoromethyl)-2H-[1,2,4]triazolo[4,3-a]pyridin-3-one. InChIKey: IUTDVBUPXJXUFW-UHFFFAOYSA-N.
| Molecular formula | C7H4F3N3O |
|---|---|
| Molecular weight | 203.12 g/mol |
| IUPAC name | 7-(trifluoromethyl)-2H-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| InChIKey | IUTDVBUPXJXUFW-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NNC2=O)C=C1C(F)(F)F |
Computed by PubChem (NCBI)