CAS 161886-18-6 appears in our catalog under these names: 2,2-Difluorobenzo(d)(1,3)dioxole-4-carbonitrile, 95%, 2,2-Difluoro-4-cyano-1,3-dioxaindane, 2,2-difluorobenzo[d][1,3]dioxole-4-carbonitrile, 98%, 98%, 2,2-DIFLUORO-4-CYANO-1,3-BENZODIOXOLE, 98%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 0,5g, 50mg, 100mg, 250mg, 500mg, 1g.
2,2-difluoro-1,3-benzodioxole-4-carbonitrile (CAS 161886-18-6) is a chemical compound with the molecular formula C8H3F2NO2 and a molecular weight of 183.11 g/mol. IUPAC name: 2,2-difluoro-1,3-benzodioxole-4-carbonitrile. InChIKey: BVCHTYSRAQFUBN-UHFFFAOYSA-N.
| Molecular formula | C8H3F2NO2 |
|---|---|
| Molecular weight | 183.11 g/mol |
| IUPAC name | 2,2-difluoro-1,3-benzodioxole-4-carbonitrile |
| InChIKey | BVCHTYSRAQFUBN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)OC(O2)(F)F)C#N |
Computed by PubChem (NCBI)