CAS 328028-36-0 appears in our catalog under these names: 3-(3,5-Dimethyl-piperidine-1-sulfonyl)-benzoic acid, 95%, 3-((3,5-Dimethylpiperidin-1-yl)sulfonyl)benzoic acid, 95%, 3-((3,5-Dimethylpiperidin-1-yl)sulfonyl)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoic acid (CAS 328028-36-0) is a chemical compound with the molecular formula C14H19NO4S and a molecular weight of 297.37 g/mol. IUPAC name: 3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoic acid. InChIKey: NQDJZPKCSPMOQQ-UHFFFAOYSA-N.
| Molecular formula | C14H19NO4S |
|---|---|
| Molecular weight | 297.37 g/mol |
| IUPAC name | 3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoic acid |
| InChIKey | NQDJZPKCSPMOQQ-UHFFFAOYSA-N |
| SMILES | CC1CC(CN(C1)S(=O)(=O)C2=CC=CC(=C2)C(=O)O)C |
Computed by PubChem (NCBI)