Products 164265-01-4
CAS 164265-01-4 appears in our catalog under these names: 6-Chloro-chroman-3-carboxylic acid, 98%, 6-Chlorochroman-3-carboxylic acid, 98%, 6-Chloro-chroman-3-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 50mg, 100mg.
6-chloro-3,4-dihydro-2H-chromene-3-carboxylic acid (CAS 164265-01-4) is a chemical compound with the molecular formula C10H9ClO3 and a molecular weight of 212.63 g/mol. IUPAC name: 6-chloro-3,4-dihydro-2H-chromene-3-carboxylic acid. InChIKey: UTLYAMDODADLNQ-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO3 |
|---|---|
| Molecular weight | 212.63 g/mol |
| IUPAC name | 6-chloro-3,4-dihydro-2H-chromene-3-carboxylic acid |
| InChIKey | UTLYAMDODADLNQ-UHFFFAOYSA-N |
| SMILES | C1C(COC2=C1C=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)