CAS 164265-09-2 is the registry number for (3S)-6-chlorochromane-3-carboxylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
(3S)-6-chloro-3,4-dihydro-2H-chromene-3-carboxylic acid (CAS 164265-09-2) is a chemical compound with the molecular formula C10H9ClO3 and a molecular weight of 212.63 g/mol. IUPAC name: (3S)-6-chloro-3,4-dihydro-2H-chromene-3-carboxylic acid. InChIKey: UTLYAMDODADLNQ-ZETCQYMHSA-N.
| Molecular formula | C10H9ClO3 |
|---|---|
| Molecular weight | 212.63 g/mol |
| IUPAC name | (3S)-6-chloro-3,4-dihydro-2H-chromene-3-carboxylic acid |
| InChIKey | UTLYAMDODADLNQ-ZETCQYMHSA-N |
| SMILES | C1[C@@H](COC2=C1C=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)