Products 164265-09-2

CAS 164265-09-2 is the registry number for (3S)-6-chlorochromane-3-carboxylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

(3S)-6-chloro-3,4-dihydro-2H-chromene-3-carboxylic acid (CAS 164265-09-2) is a chemical compound with the molecular formula C10H9ClO3 and a molecular weight of 212.63 g/mol. IUPAC name: (3S)-6-chloro-3,4-dihydro-2H-chromene-3-carboxylic acid. InChIKey: UTLYAMDODADLNQ-ZETCQYMHSA-N.

Identity
Molecular formulaC10H9ClO3
Molecular weight212.63 g/mol
IUPAC name(3S)-6-chloro-3,4-dihydro-2H-chromene-3-carboxylic acid
InChIKeyUTLYAMDODADLNQ-ZETCQYMHSA-N
SMILESC1[C@@H](COC2=C1C=C(C=C2)Cl)C(=O)O

Computed by PubChem (NCBI)