CAS 164470-64-8 appears in our catalog under these names: 4–(((((9H–Fluoren–9–yl)methoxy)carbonyl)amino)methyl)benzoic acid, Fmoc-4-Amb-OH, Fmoc-(4-aminomethyl) benzoic acid, 4-[[(9H-Fluoren-9-ylmethoxy)carbonyl]aminomethyl]benzoic Acid, >98.0%(HPLC)(T), Fmoc-4-Amb-OH 97%. Offered by: GLPBio, Iris Biotech, Biosynth, TCI, Ambeed. Available pack sizes: 100g, 10g, 25g, 500g, 5g, 1g.
4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]benzoic acid (CAS 164470-64-8) is a chemical compound with the molecular formula C23H19NO4 and a molecular weight of 373.4 g/mol. IUPAC name: 4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]benzoic acid. InChIKey: JRHUROPSUJVMNH-UHFFFAOYSA-N.
| Molecular formula | C23H19NO4 |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | 4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]benzoic acid |
| InChIKey | JRHUROPSUJVMNH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)