CAS 165682-81-5 is the registry number for 2-((2-Chlorophenyl)amino)thiazole-4-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
2-(2-chloroanilino)-1,3-thiazole-4-carboxylic acid (CAS 165682-81-5) is a chemical compound with the molecular formula C10H7ClN2O2S and a molecular weight of 254.69 g/mol. IUPAC name: 2-(2-chloroanilino)-1,3-thiazole-4-carboxylic acid. InChIKey: OMOCHAFOYVWXNL-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O2S |
|---|---|
| Molecular weight | 254.69 g/mol |
| IUPAC name | 2-(2-chloroanilino)-1,3-thiazole-4-carboxylic acid |
| InChIKey | OMOCHAFOYVWXNL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC2=NC(=CS2)C(=O)O)Cl |
Computed by PubChem (NCBI)