CAS 166978-48-9 appears in our catalog under these names: 4,4-Dimethyl-7-ethynyl-1-tetralone, 7–ethynyl–4,4–dimethyl–3,4–dihydronaphthalen–1(2H)–one. Offered by: TRC, GLPBio. Available pack sizes: 100mg, 25mg, 50mg, 1g, 250mg.
7-ethynyl-4,4-dimethyl-2,3-dihydronaphthalen-1-one (CAS 166978-48-9) is a chemical compound with the molecular formula C14H14O and a molecular weight of 198.26 g/mol. IUPAC name: 7-ethynyl-4,4-dimethyl-2,3-dihydronaphthalen-1-one. InChIKey: FSENXSHCDBCKEZ-UHFFFAOYSA-N.
| Molecular formula | C14H14O |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | 7-ethynyl-4,4-dimethyl-2,3-dihydronaphthalen-1-one |
| InChIKey | FSENXSHCDBCKEZ-UHFFFAOYSA-N |
| SMILES | CC1(CCC(=O)C2=C1C=CC(=C2)C#C)C |
Computed by PubChem (NCBI)