Products 167223-42-9
CAS 167223-42-9 appears in our catalog under these names: D-Isoleucine Methyl Ester Hydrochloride, (2R,3R)-Methyl 2-amino-3-methylpentanoate hydrochloride, 98%, 98%. Offered by: TRC, Chemat. Available pack sizes: 100mg, 250mg, 25mg, 50mg, 200mg, 1g.
Methyl (2R,3R)-2-amino-3-methylpentanoate;hydrochloride (CAS 167223-42-9) is a chemical compound with the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. IUPAC name: methyl (2R,3R)-2-amino-3-methylpentanoate;hydrochloride. InChIKey: GGTBEWGOPAFTTH-KGZKBUQUSA-N.
| Molecular formula | C7H16ClNO2 |
|---|---|
| Molecular weight | 181.66 g/mol |
| IUPAC name | methyl (2R,3R)-2-amino-3-methylpentanoate;hydrochloride |
| InChIKey | GGTBEWGOPAFTTH-KGZKBUQUSA-N |
| SMILES | CC[C@@H](C)[C@H](C(=O)OC)N.Cl |
Computed by PubChem (NCBI)