Products 2127175-24-8

CAS 2127175-24-8 is the registry number for Methyl 2-ao-3-methylpentanoate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.

Structural formula: {0} (CAS {1})

Methyl 2-amino-3-methylpentanoate;hydrochloride (CAS 2127175-24-8) is a chemical compound with the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. IUPAC name: methyl 2-amino-3-methylpentanoate;hydrochloride. InChIKey: GGTBEWGOPAFTTH-UHFFFAOYSA-N.

Identity
Molecular formulaC7H16ClNO2
Molecular weight181.66 g/mol
IUPAC namemethyl 2-amino-3-methylpentanoate;hydrochloride
InChIKeyGGTBEWGOPAFTTH-UHFFFAOYSA-N
SMILESCCC(C)C(C(=O)OC)N.Cl

Computed by PubChem (NCBI)