Products 60667-85-8
CAS 60667-85-8 appears in our catalog under these names: (2R，3S)–2–Amino–3–methyl–pentanoic acid methyl ester hydrochloride, (2R,3S)-2-Amino-3-methyl-pentanoic acid methyl ester hydrochloride 97%, (2R,3S)-2-Amino-3-methylpentanoic acid methyl ester hydrochloride, 97%, 97%, (2R,3S)-2-Amino-3-methyl-pentanoic acid methyl ester hydrochloride, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl (2R,3S)-2-amino-3-methylpentanoate;hydrochloride (CAS 60667-85-8) is a chemical compound with the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. IUPAC name: methyl (2R,3S)-2-amino-3-methylpentanoate;hydrochloride. InChIKey: GGTBEWGOPAFTTH-RIHPBJNCSA-N.
| Molecular formula | C7H16ClNO2 |
|---|---|
| Molecular weight | 181.66 g/mol |
| IUPAC name | methyl (2R,3S)-2-amino-3-methylpentanoate;hydrochloride |
| InChIKey | GGTBEWGOPAFTTH-RIHPBJNCSA-N |
| SMILES | CC[C@H](C)[C@H](C(=O)OC)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
(2R,3S)-2-Amino-3-methyl-pentanoic acid methyl ester hydrochloride, D-Alloisoleucine, methyl ester, hydrochloride, methyl D-alloisoleucinate hydrochloride, methyl (2R,3S)-2-amino-3-methylpentanoate;hydrochloride, L-Alloisoleucine methyl ester hydrochloride, (2R,3S)-2-Amino-3-methylpentanoic acid methyl ester hydrochloride, D-alloisoleucine methyl ester hydrochloride, Methyl D-isoleucinate HCl, GGTBEWGOPAFTTH-RIHPBJNCSA-N, (D)-alloisoleucine methyl ester hydrochloride