Products 16732-75-5
CAS 16732-75-5 appears in our catalog under these names: 6-Chloroindole-2-carboxylic acid, 6-Chloroindole-2-carboxylic acid 98%, 6-Chloroindole-2-carboxylic acid, 98%, 98%, 6-Chloroindole-2-carboxylic acid, 95%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 50g, 250mg, 1g, 5g, 25g, 10g.
6-chloro-1H-indole-2-carboxylic acid (CAS 16732-75-5) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: 6-chloro-1H-indole-2-carboxylic acid. InChIKey: BKPSJOSKWKTWAG-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 6-chloro-1H-indole-2-carboxylic acid |
| InChIKey | BKPSJOSKWKTWAG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)NC(=C2)C(=O)O |
Computed by PubChem (NCBI)