CAS 1700528-53-5 is the registry number for 4,6-Dichloro-7-methoxyquinoline, 98%. Offered by: AmBeed. Available pack sizes: 1g.
4,6-dichloro-7-methoxyquinoline (CAS 1700528-53-5) is a chemical compound with the molecular formula C10H7Cl2NO and a molecular weight of 228.07 g/mol. IUPAC name: 4,6-dichloro-7-methoxyquinoline. InChIKey: ZGKMHPTTXVOXFQ-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NO |
|---|---|
| Molecular weight | 228.07 g/mol |
| IUPAC name | 4,6-dichloro-7-methoxyquinoline |
| InChIKey | ZGKMHPTTXVOXFQ-UHFFFAOYSA-N |
| SMILES | COC1=CC2=NC=CC(=C2C=C1Cl)Cl |
Computed by PubChem (NCBI)