CAS 171504-98-6 appears in our catalog under these names: Methyl 1,4-Bis(Boc)-2-piperazinecarboxylate, 98%, 98%, Methyl 1,4–Bis(Boc)–2–piperazinecarboxylate, Methyl 1,4-Bis(Boc)-2-piperazinecarboxylate 95%, 1,4-Di-tert-butyl 2-methyl piperazine-1,2,4-tricarboxylate, 98%. Offered by: Chemat, GLPBio, Ambeed, Fluorochem. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g, 25g, 100mg, 100g.
1-O,4-O-ditert-butyl 2-O-methyl piperazine-1,2,4-tricarboxylate (CAS 171504-98-6) is a chemical compound with the molecular formula C16H28N2O6 and a molecular weight of 344.40 g/mol. IUPAC name: 1-O,4-O-ditert-butyl 2-O-methyl piperazine-1,2,4-tricarboxylate. InChIKey: QKNSGUCCNZBAAJ-UHFFFAOYSA-N.
| Molecular formula | C16H28N2O6 |
|---|---|
| Molecular weight | 344.40 g/mol |
| IUPAC name | 1-O,4-O-ditert-butyl 2-O-methyl piperazine-1,2,4-tricarboxylate |
| InChIKey | QKNSGUCCNZBAAJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(C1)C(=O)OC)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)