Products 171817-95-1
CAS 171817-95-1 appears in our catalog under these names: 2-(1H-Indole-3-carboxamido)benzoic acid, 2-[(1H-Indol-3-ylcarbonyl)amino]benzoic acid, 2-(1H-Indole-3-carboxamido)benzoic acid, ≥98%. Offered by: Biosynth, MedChemExpress, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote, 20mg.
2-(1H-indole-3-carbonylamino)benzoic acid (CAS 171817-95-1) is a chemical compound with the molecular formula C16H12N2O3 and a molecular weight of 280.28 g/mol. IUPAC name: 2-(1H-indole-3-carbonylamino)benzoic acid. InChIKey: DRWUBVFXVNQIND-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O3 |
|---|---|
| Molecular weight | 280.28 g/mol |
| IUPAC name | 2-(1H-indole-3-carbonylamino)benzoic acid |
| InChIKey | DRWUBVFXVNQIND-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C(=O)NC3=CC=CC=C3C(=O)O |
Computed by PubChem (NCBI)