CAS 788799-69-9 appears in our catalog under these names: (S)-1,4-N-Diboc-2-piperazine-2-carboxylic acid, 98%, 98%, (S)-1,4-Bis(tert-butoxycarbonyl)piperazine-2-carboxylic acid, 95%, (S)-1,4-Bis(tert-butoxycarbonyl)piperazine-2-carboxylic acid, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 20g.
(2S)-1,4-bis[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid (CAS 788799-69-9) is a chemical compound with the molecular formula C15H26N2O6 and a molecular weight of 330.38 g/mol. IUPAC name: (2S)-1,4-bis[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid. InChIKey: IIZGWFQKLVCLLA-JTQLQIEISA-N.
| Molecular formula | C15H26N2O6 |
|---|---|
| Molecular weight | 330.38 g/mol |
| IUPAC name | (2S)-1,4-bis[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid |
| InChIKey | IIZGWFQKLVCLLA-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN([C@@H](C1)C(=O)O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)