Products 173996-48-0
CAS 173996-48-0 appears in our catalog under these names: 5,6-Difluoro-2,3-dihydro-1H-inden-2-amine hydrochloride, 5,6-difluoro-2,3-dihydro-1H-inden-2-aminehydrochloride, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g.
5,6-difluoro-2,3-dihydro-1H-inden-2-amine;hydrochloride (CAS 173996-48-0) is a chemical compound with the molecular formula C9H10ClF2N and a molecular weight of 205.63 g/mol. IUPAC name: 5,6-difluoro-2,3-dihydro-1H-inden-2-amine;hydrochloride. InChIKey: AWYTYXIPCLDPNO-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF2N |
|---|---|
| Molecular weight | 205.63 g/mol |
| IUPAC name | 5,6-difluoro-2,3-dihydro-1H-inden-2-amine;hydrochloride |
| InChIKey | AWYTYXIPCLDPNO-UHFFFAOYSA-N |
| SMILES | C1C(CC2=CC(=C(C=C21)F)F)N.Cl |
Computed by PubChem (NCBI)